C19H23FN2O8 — CID 172580563
[5-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]oxolan-2-yl]methyl 2-fluorobenzoate;methyl hydrogen carbonate (PubChem CID 172580563) has the molecular formula C19H23FN2O8 and a molecular weight of 426.40 g/mol. Its IUPAC name is [5-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]oxolan-2-yl]methyl 2-fluorobenzoate;methyl hydrogen carbonate.
| Compound Name | [5-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]oxolan-2-yl]methyl 2-fluorobenzoate;methyl hydrogen carbonate |
|---|---|
| PubChem CID | 172580563 |
| Molecular Formula | C19H23FN2O8 |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | [5-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]oxolan-2-yl]methyl 2-fluorobenzoate;methyl hydrogen carbonate |
| SMILES | CN(/C=C\C(=O)NC=O)C1CCC(COC(=O)c2ccccc2F)O1.COC(=O)O |
| InChI | InChI=1S/C17H19FN2O5.C2H4O3/c1-20(9-8-15(22)19-11-21)16-7-6-12(25-16)10-24-17(23)13-4-2-3-5-14(13)18;1-5-2(3)4/h2-5,8-9,11-12,16H,6-7,10H2,1H3,(H,19,21,22);1H3,(H,3,4)/b9-8-; |
| InChIKey | AISGDFAMRYHYSF-UOQXYWCXSA-N |
| XLogP | 1.52 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|