C22H39N3O8 — CID 144766711
[5-[[(Z)-3-amino-3-formyliminoprop-1-enyl]-methylamino]oxolan-2-yl]methyl 2-methylpropanoate;bis(2-methylpropanoic acid) (PubChem CID 144766711) has the molecular formula C22H39N3O8 and a molecular weight of 473.57 g/mol. Its IUPAC name is [5-[[(Z)-3-amino-3-formyliminoprop-1-enyl]-methylamino]oxolan-2-yl]methyl 2-methylpropanoate;bis(2-methylpropanoic acid).
| Compound Name | [5-[[(Z)-3-amino-3-formyliminoprop-1-enyl]-methylamino]oxolan-2-yl]methyl 2-methylpropanoate;bis(2-methylpropanoic acid) |
|---|---|
| PubChem CID | 144766711 |
| Molecular Formula | C22H39N3O8 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | [5-[[(Z)-3-amino-3-formyliminoprop-1-enyl]-methylamino]oxolan-2-yl]methyl 2-methylpropanoate;bis(2-methylpropanoic acid) |
| SMILES | CC(C)C(=O)O.CC(C)C(=O)O.CC(C)C(=O)OCC1CCC(N(C)/C=C\C(N)=N\C=O)O1 |
| InChI | InChI=1S/C14H23N3O4.2C4H8O2/c1-10(2)14(19)20-8-11-4-5-13(21-11)17(3)7-6-12(15)16-9-18;2*1-3(2)4(5)6/h6-7,9-11,13H,4-5,8H2,1-3H3,(H2,15,16,18);2*3H,1-2H3,(H,5,6)/b7-6-;; |
| InChIKey | AJXQYYWRNWBVQF-AQTVDGORSA-N |
| XLogP | 2.10 |
| TPSA | 168.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|