C9H15NO3 — CID 171628813
(Z)-3-[[5-(hydroxymethyl)oxolan-2-yl]-methylamino]prop-2-enal (PubChem CID 171628813) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is (Z)-3-[[5-(hydroxymethyl)oxolan-2-yl]-methylamino]prop-2-enal.
| Compound Name | (Z)-3-[[5-(hydroxymethyl)oxolan-2-yl]-methylamino]prop-2-enal |
|---|---|
| PubChem CID | 171628813 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | (Z)-3-[[5-(hydroxymethyl)oxolan-2-yl]-methylamino]prop-2-enal |
| SMILES | CN(/C=C\C=O)C1CCC(CO)O1 |
| InChI | InChI=1S/C9H15NO3/c1-10(5-2-6-11)9-4-3-8(7-12)13-9/h2,5-6,8-9,12H,3-4,7H2,1H3/b5-2- |
| InChIKey | ISVBJDJFMCOKSY-DJWKRKHSSA-N |
| XLogP | 0.13 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|