C10H18N4O3 — CID 144762773
N-[(NZ)-N-[[[5-(hydroxymethyl)oxolan-2-yl]-methylamino]methylidene]-N'-methylcarbamimidoyl]formamide (PubChem CID 144762773) has the molecular formula C10H18N4O3 and a molecular weight of 242.28 g/mol. Its IUPAC name is N-[(NZ)-N-[[[5-(hydroxymethyl)oxolan-2-yl]-methylamino]methylidene]-N'-methylcarbamimidoyl]formamide.
| Compound Name | N-[(NZ)-N-[[[5-(hydroxymethyl)oxolan-2-yl]-methylamino]methylidene]-N'-methylcarbamimidoyl]formamide |
|---|---|
| PubChem CID | 144762773 |
| Molecular Formula | C10H18N4O3 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | N-[(NZ)-N-[[[5-(hydroxymethyl)oxolan-2-yl]-methylamino]methylidene]-N'-methylcarbamimidoyl]formamide |
| SMILES | C/N=C(/N=C\N(C)C1CCC(CO)O1)NC=O |
| InChI | InChI=1S/C10H18N4O3/c1-11-10(13-7-16)12-6-14(2)9-4-3-8(5-15)17-9/h6-9,15H,3-5H2,1-2H3,(H,11,13,16)/b12-6- |
| InChIKey | RBLIRHSCGQCKEF-SDQBBNPISA-N |
| XLogP | -0.82 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|