C11H18F2N2O4 — CID 169252325
[4-fluoro-5-[[(E)-2-fluoroprop-1-enyl]-methylamino]oxolan-2-yl]methanol;N-formylformamide (PubChem CID 169252325) has the molecular formula C11H18F2N2O4 and a molecular weight of 280.27 g/mol. Its IUPAC name is [4-fluoro-5-[[(E)-2-fluoroprop-1-enyl]-methylamino]oxolan-2-yl]methanol;N-formylformamide.
| Compound Name | [4-fluoro-5-[[(E)-2-fluoroprop-1-enyl]-methylamino]oxolan-2-yl]methanol;N-formylformamide |
|---|---|
| PubChem CID | 169252325 |
| Molecular Formula | C11H18F2N2O4 |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | [4-fluoro-5-[[(E)-2-fluoroprop-1-enyl]-methylamino]oxolan-2-yl]methanol;N-formylformamide |
| SMILES | C/C(F)=C\N(C)C1OC(CO)CC1F.O=CNC=O |
| InChI | InChI=1S/C9H15F2NO2.C2H3NO2/c1-6(10)4-12(2)9-8(11)3-7(5-13)14-9;4-1-3-2-5/h4,7-9,13H,3,5H2,1-2H3;1-2H,(H,3,4,5)/b6-4+; |
| InChIKey | FJUOQBMSXQNWCM-CVDVRWGVSA-N |
| XLogP | 0.08 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|