C13H22F2N2O5 — CID 169252383
ethanol;(E)-2-fluoro-3-[[3-fluoro-5-(hydroxymethyl)-5-methyloxolan-2-yl]-methylamino]-N-formylprop-2-enamide (PubChem CID 169252383) has the molecular formula C13H22F2N2O5 and a molecular weight of 324.32 g/mol. Its IUPAC name is ethanol;(E)-2-fluoro-3-[[3-fluoro-5-(hydroxymethyl)-5-methyloxolan-2-yl]-methylamino]-N-formylprop-2-enamide.
| Compound Name | ethanol;(E)-2-fluoro-3-[[3-fluoro-5-(hydroxymethyl)-5-methyloxolan-2-yl]-methylamino]-N-formylprop-2-enamide |
|---|---|
| PubChem CID | 169252383 |
| Molecular Formula | C13H22F2N2O5 |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | ethanol;(E)-2-fluoro-3-[[3-fluoro-5-(hydroxymethyl)-5-methyloxolan-2-yl]-methylamino]-N-formylprop-2-enamide |
| SMILES | CCO.CN(/C=C(/F)C(=O)NC=O)C1OC(C)(CO)CC1F |
| InChI | InChI=1S/C11H16F2N2O4.C2H6O/c1-11(5-16)3-7(12)10(19-11)15(2)4-8(13)9(18)14-6-17;1-2-3/h4,6-7,10,16H,3,5H2,1-2H3,(H,14,17,18);3H,2H2,1H3/b8-4+; |
| InChIKey | PGFQHYXFWKUYAK-ZFXMFRGYSA-N |
| XLogP | -0.16 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|