C11H18N2O5 — CID 178052092
(Z)-N-formyl-3-[[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-methylamino]-2-methylprop-2-enamide (PubChem CID 178052092) has the molecular formula C11H18N2O5 and a molecular weight of 258.27 g/mol. Its IUPAC name is (Z)-N-formyl-3-[[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-methylamino]-2-methylprop-2-enamide.
| Compound Name | (Z)-N-formyl-3-[[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-methylamino]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 178052092 |
| Molecular Formula | C11H18N2O5 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | (Z)-N-formyl-3-[[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-methylamino]-2-methylprop-2-enamide |
| SMILES | C/C(=C/N(C)C1CC(O)C(CO)O1)C(=O)NC=O |
| InChI | InChI=1S/C11H18N2O5/c1-7(11(17)12-6-15)4-13(2)10-3-8(16)9(5-14)18-10/h4,6,8-10,14,16H,3,5H2,1-2H3,(H,12,15,17)/b7-4- |
| InChIKey | WGPKRGXVUSEBEP-DAXSKMNVSA-N |
| XLogP | -1.44 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|