C18H25N3O4 — CID 176659075
N-[(2Z)-1-amino-2-[[[(4R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-methylamino]methylidene]deca-3,9-diynylidene]formamide (PubChem CID 176659075) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is N-[(2Z)-1-amino-2-[[[(4R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-methylamino]methylidene]deca-3,9-diynylidene]formamide.
| Compound Name | N-[(2Z)-1-amino-2-[[[(4R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-methylamino]methylidene]deca-3,9-diynylidene]formamide |
|---|---|
| PubChem CID | 176659075 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | N-[(2Z)-1-amino-2-[[[(4R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-methylamino]methylidene]deca-3,9-diynylidene]formamide |
| SMILES | C#CCCCCC#CC(=C/N(C)C1C[C@@H](O)C(CO)O1)/C(N)=N/C=O |
| InChI | InChI=1S/C18H25N3O4/c1-3-4-5-6-7-8-9-14(18(19)20-13-23)11-21(2)17-10-15(24)16(12-22)25-17/h1,11,13,15-17,22,24H,4-7,10,12H2,2H3,(H2,19,20,23)/b14-11-/t15-,16?,17?/m1/s1 |
| InChIKey | JCZBTVWATJDXCC-VOXZAXERSA-N |
| XLogP | -0.02 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|