C8H14N4O5 — CID 88554016
N-[amino-[[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]carbamoylamino]methylidene]formamide (PubChem CID 88554016) has the molecular formula C8H14N4O5 and a molecular weight of 246.22 g/mol. Its IUPAC name is N-[amino-[[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]carbamoylamino]methylidene]formamide.
| Compound Name | N-[amino-[[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]carbamoylamino]methylidene]formamide |
|---|---|
| PubChem CID | 88554016 |
| Molecular Formula | C8H14N4O5 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | N-[amino-[[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]carbamoylamino]methylidene]formamide |
| SMILES | N/C(=N\C=O)NC(=O)N[C@H]1CC(O)[C@@H](CO)O1 |
| InChI | InChI=1S/C8H14N4O5/c9-7(10-3-14)12-8(16)11-6-1-4(15)5(2-13)17-6/h3-6,13,15H,1-2H2,(H4,9,10,11,12,14,16)/t4?,5-,6-/m1/s1 |
| InChIKey | MJPMQCAEDYSGQK-YSLANXFLSA-N |
| XLogP | -2.78 |
| TPSA | 146.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|