C9H14FN3O4 — CID 134268043
(E)-N-[4-amino-5-(hydroxymethyl)oxolan-2-yl]-2-fluoro-3-formamidoprop-2-enamide (PubChem CID 134268043) has the molecular formula C9H14FN3O4 and a molecular weight of 247.23 g/mol. Its IUPAC name is (E)-N-[4-amino-5-(hydroxymethyl)oxolan-2-yl]-2-fluoro-3-formamidoprop-2-enamide.
| Compound Name | (E)-N-[4-amino-5-(hydroxymethyl)oxolan-2-yl]-2-fluoro-3-formamidoprop-2-enamide |
|---|---|
| PubChem CID | 134268043 |
| Molecular Formula | C9H14FN3O4 |
| Molecular Weight | 247.23 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | (E)-N-[4-amino-5-(hydroxymethyl)oxolan-2-yl]-2-fluoro-3-formamidoprop-2-enamide |
| SMILES | NC1CC(NC(=O)/C(F)=C\NC=O)OC1CO |
| InChI | InChI=1S/C9H14FN3O4/c10-5(2-12-4-15)9(16)13-8-1-6(11)7(3-14)17-8/h2,4,6-8,14H,1,3,11H2,(H,12,15)(H,13,16)/b5-2+ |
| InChIKey | NPNDOEITOKQQML-GORDUTHDSA-N |
| XLogP | -1.91 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.23 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|