C6H12N2O6P+ — CID 174069338
[(2R,5R)-5-(carbamoylamino)-2-(hydroxymethyl)oxolan-3-yl]oxy-hydroxy-oxophosphanium (PubChem CID 174069338) has the molecular formula C6H12N2O6P+ and a molecular weight of 239.14 g/mol. Its IUPAC name is [(2R,5R)-5-(carbamoylamino)-2-(hydroxymethyl)oxolan-3-yl]oxy-hydroxy-oxophosphanium.
| Compound Name | [(2R,5R)-5-(carbamoylamino)-2-(hydroxymethyl)oxolan-3-yl]oxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 174069338 |
| Molecular Formula | C6H12N2O6P+ |
| Molecular Weight | 239.14 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | [(2R,5R)-5-(carbamoylamino)-2-(hydroxymethyl)oxolan-3-yl]oxy-hydroxy-oxophosphanium |
| SMILES | NC(=O)N[C@H]1CC(O[P+](=O)O)[C@@H](CO)O1 |
| InChI | InChI=1S/C6H11N2O6P/c7-6(10)8-5-1-3(14-15(11)12)4(2-9)13-5/h3-5,9H,1-2H2,(H3-,7,8,10,11,12)/p+1/t3?,4-,5-/m1/s1 |
| InChIKey | XEURSZFWPJOVSP-YZNZAMEGSA-O |
| XLogP | -1.20 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.14 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|