About [(2R,4R,5R)-4-methoxy-5-(methoxymethyl)oxolan-2-yl]urea
[(2R,4R,5R)-4-methoxy-5-(methoxymethyl)oxolan-2-yl]urea (PubChem CID 59059665) has the molecular formula C8H16N2O4
and a molecular weight of 204.23 g/mol. Its IUPAC name is [(2R,4R,5R)-4-methoxy-5-(methoxymethyl)oxolan-2-yl]urea.
Molecular Properties
| Compound Name | [(2R,4R,5R)-4-methoxy-5-(methoxymethyl)oxolan-2-yl]urea |
| PubChem CID | 59059665 |
| Molecular Formula | C8H16N2O4 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | [(2R,4R,5R)-4-methoxy-5-(methoxymethyl)oxolan-2-yl]urea |
| SMILES | COC[C@H]1O[C@@H](NC(N)=O)C[C@H]1OC |
| InChI | InChI=1S/C8H16N2O4/c1-12-4-6-5(13-2)3-7(14-6)10-8(9)11/h5-7H,3-4H2,1-2H3,(H3,9,10,11)/t5-,6-,7-/m1/s1 |
| InChIKey | KHVPMFLYFLUOOH-FSDSQADBSA-N |
| XLogP | -0.57 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2R,4R,5R)-4-methoxy-5-(methoxymethyl)oxolan-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,4R,5R)-4-methoxy-5-(methoxymethyl)oxolan-2-yl]urea?
The IUPAC name of [(2R,4R,5R)-4-methoxy-5-(methoxymethyl)oxolan-2-yl]urea (CID 59059665) is [(2R,4R,5R)-4-methoxy-5-(methoxymethyl)oxolan-2-yl]urea.
What is the SMILES notation for [(2R,4R,5R)-4-methoxy-5-(methoxymethyl)oxolan-2-yl]urea?
The canonical SMILES for [(2R,4R,5R)-4-methoxy-5-(methoxymethyl)oxolan-2-yl]urea is COC[C@H]1O[C@@H](NC(N)=O)C[C@H]1OC.
What is the InChIKey of [(2R,4R,5R)-4-methoxy-5-(methoxymethyl)oxolan-2-yl]urea?
The InChIKey is KHVPMFLYFLUOOH-FSDSQADBSA-N. The full InChI is InChI=1S/C8H16N2O4/c1-12-4-6-5(13-2)3-7(14-6)10-8(9)11/h5-7H,3-4H2,1-2H3,(H3,9,10,11)/t5-,6-,7-/m1/s1.
What are the key properties of [(2R,4R,5R)-4-methoxy-5-(methoxymethyl)oxolan-2-yl]urea?
[(2R,4R,5R)-4-methoxy-5-(methoxymethyl)oxolan-2-yl]urea has a molecular weight of 204.23 g/mol, XLogP of -0.57, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,4R,5R)-4-methoxy-5-(methoxymethyl)oxolan-2-yl]urea is sourced from PubChem (CID 59059665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).