C9H16O6 — CID 58492842
[(2S,5R)-4,5-dimethoxyoxolan-2-yl]methyl 2-hydroxyacetate (PubChem CID 58492842) has the molecular formula C9H16O6 and a molecular weight of 220.22 g/mol. Its IUPAC name is [(2S,5R)-4,5-dimethoxyoxolan-2-yl]methyl 2-hydroxyacetate.
| Compound Name | [(2S,5R)-4,5-dimethoxyoxolan-2-yl]methyl 2-hydroxyacetate |
|---|---|
| PubChem CID | 58492842 |
| Molecular Formula | C9H16O6 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | [(2S,5R)-4,5-dimethoxyoxolan-2-yl]methyl 2-hydroxyacetate |
| SMILES | COC1C[C@@H](COC(=O)CO)O[C@H]1OC |
| InChI | InChI=1S/C9H16O6/c1-12-7-3-6(15-9(7)13-2)5-14-8(11)4-10/h6-7,9-10H,3-5H2,1-2H3/t6-,7?,9+/m0/s1 |
| InChIKey | KSJACKBVTQWQCA-JFOAVASISA-N |
| XLogP | -0.70 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |