About [(2R,3S,5S)-5-(bromooxymethyl)-2-methoxyoxolan-3-yl] trifluoromethanesulfonate
[(2R,3S,5S)-5-(bromooxymethyl)-2-methoxyoxolan-3-yl] trifluoromethanesulfonate (PubChem CID 154612466) has the molecular formula C7H10BrF3O6S
and a molecular weight of 359.12 g/mol. Its IUPAC name is [(2R,3S,5S)-5-(bromooxymethyl)-2-methoxyoxolan-3-yl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [(2R,3S,5S)-5-(bromooxymethyl)-2-methoxyoxolan-3-yl] trifluoromethanesulfonate |
| PubChem CID | 154612466 |
| Molecular Formula | C7H10BrF3O6S |
| Molecular Weight | 359.12 g/mol |
| Exact Mass | 357.93 |
| IUPAC Name | [(2R,3S,5S)-5-(bromooxymethyl)-2-methoxyoxolan-3-yl] trifluoromethanesulfonate |
| SMILES | CO[C@@H]1O[C@H](COBr)C[C@@H]1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C7H10BrF3O6S/c1-14-6-5(2-4(16-6)3-15-8)17-18(12,13)7(9,10)11/h4-6H,2-3H2,1H3/t4-,5-,6+/m0/s1 |
| InChIKey | UVFHQSOFSFBMNZ-HCWXCVPCSA-N |
| XLogP | 1.31 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.12 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [(2R,3S,5S)-5-(bromooxymethyl)-2-methoxyoxolan-3-yl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3S,5S)-5-(bromooxymethyl)-2-methoxyoxolan-3-yl] trifluoromethanesulfonate?
The IUPAC name of [(2R,3S,5S)-5-(bromooxymethyl)-2-methoxyoxolan-3-yl] trifluoromethanesulfonate (CID 154612466) is [(2R,3S,5S)-5-(bromooxymethyl)-2-methoxyoxolan-3-yl] trifluoromethanesulfonate.
What is the SMILES notation for [(2R,3S,5S)-5-(bromooxymethyl)-2-methoxyoxolan-3-yl] trifluoromethanesulfonate?
The canonical SMILES for [(2R,3S,5S)-5-(bromooxymethyl)-2-methoxyoxolan-3-yl] trifluoromethanesulfonate is CO[C@@H]1O[C@H](COBr)C[C@@H]1OS(=O)(=O)C(F)(F)F.
What is the InChIKey of [(2R,3S,5S)-5-(bromooxymethyl)-2-methoxyoxolan-3-yl] trifluoromethanesulfonate?
The InChIKey is UVFHQSOFSFBMNZ-HCWXCVPCSA-N. The full InChI is InChI=1S/C7H10BrF3O6S/c1-14-6-5(2-4(16-6)3-15-8)17-18(12,13)7(9,10)11/h4-6H,2-3H2,1H3/t4-,5-,6+/m0/s1.
What are the key properties of [(2R,3S,5S)-5-(bromooxymethyl)-2-methoxyoxolan-3-yl] trifluoromethanesulfonate?
[(2R,3S,5S)-5-(bromooxymethyl)-2-methoxyoxolan-3-yl] trifluoromethanesulfonate has a molecular weight of 359.12 g/mol, XLogP of 1.31, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3S,5S)-5-(bromooxymethyl)-2-methoxyoxolan-3-yl] trifluoromethanesulfonate is sourced from PubChem (CID 154612466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).