C7H10BrF3O6S — CID 154612466
[(2R,3S,5S)-5-(bromooxymethyl)-2-methoxyoxolan-3-yl] trifluoromethanesulfonate (PubChem CID 154612466) has the molecular formula C7H10BrF3O6S and a molecular weight of 359.12 g/mol. Its IUPAC name is [(2R,3S,5S)-5-(bromooxymethyl)-2-methoxyoxolan-3-yl] trifluoromethanesulfonate.
| Compound Name | [(2R,3S,5S)-5-(bromooxymethyl)-2-methoxyoxolan-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 154612466 |
| Molecular Formula | C7H10BrF3O6S |
| Molecular Weight | 359.12 g/mol |
| Exact Mass | 357.93 |
| IUPAC Name | [(2R,3S,5S)-5-(bromooxymethyl)-2-methoxyoxolan-3-yl] trifluoromethanesulfonate |
| SMILES | CO[C@@H]1O[C@H](COBr)C[C@@H]1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C7H10BrF3O6S/c1-14-6-5(2-4(16-6)3-15-8)17-18(12,13)7(9,10)11/h4-6H,2-3H2,1H3/t4-,5-,6+/m0/s1 |
| InChIKey | UVFHQSOFSFBMNZ-HCWXCVPCSA-N |
| XLogP | 1.31 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.12 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|