C10H15F3O8S — CID 122391441
[(4aR,6R,7S,8S,8aR)-7,8-dimethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] trifluoromethanesulfonate (PubChem CID 122391441) has the molecular formula C10H15F3O8S and a molecular weight of 352.28 g/mol. Its IUPAC name is [(4aR,6R,7S,8S,8aR)-7,8-dimethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] trifluoromethanesulfonate.
| Compound Name | [(4aR,6R,7S,8S,8aR)-7,8-dimethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 122391441 |
| Molecular Formula | C10H15F3O8S |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | [(4aR,6R,7S,8S,8aR)-7,8-dimethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] trifluoromethanesulfonate |
| SMILES | CO[C@@H]1[C@H](OC)[C@@H](OS(=O)(=O)C(F)(F)F)O[C@@H]2COCO[C@@H]12 |
| InChI | InChI=1S/C10H15F3O8S/c1-16-7-6-5(3-18-4-19-6)20-9(8(7)17-2)21-22(14,15)10(11,12)13/h5-9H,3-4H2,1-2H3/t5-,6-,7+,8+,9-/m1/s1 |
| InChIKey | XIKBFIDTWNRUTO-XGQMLPDNSA-N |
| XLogP | -0.02 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|