C12H20O7 — CID 177393525
[(4aR,6S,7R,8R,8aR)-7-hydroxy-6-methoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2-methylpropanoate (PubChem CID 177393525) has the molecular formula C12H20O7 and a molecular weight of 276.29 g/mol. Its IUPAC name is [(4aR,6S,7R,8R,8aR)-7-hydroxy-6-methoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2-methylpropanoate.
| Compound Name | [(4aR,6S,7R,8R,8aR)-7-hydroxy-6-methoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 177393525 |
| Molecular Formula | C12H20O7 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | [(4aR,6S,7R,8R,8aR)-7-hydroxy-6-methoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2-methylpropanoate |
| SMILES | CO[C@H]1O[C@@H]2COCO[C@H]2[C@H](OC(=O)C(C)C)[C@H]1O |
| InChI | InChI=1S/C12H20O7/c1-6(2)11(14)19-10-8(13)12(15-3)18-7-4-16-5-17-9(7)10/h6-10,12-13H,4-5H2,1-3H3/t7-,8-,9-,10-,12+/m1/s1 |
| InChIKey | XHRWBQTVBZVBLV-CDPPZIPSSA-N |
| XLogP | -0.34 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |