C9H16O6 — CID 102240590
(4aR,6S,7R,8S,8aS)-6-methoxy-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol (PubChem CID 102240590) has the molecular formula C9H16O6 and a molecular weight of 220.22 g/mol. Its IUPAC name is (4aR,6S,7R,8S,8aS)-6-methoxy-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol.
| Compound Name | (4aR,6S,7R,8S,8aS)-6-methoxy-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
|---|---|
| PubChem CID | 102240590 |
| Molecular Formula | C9H16O6 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | (4aR,6S,7R,8S,8aS)-6-methoxy-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
| SMILES | CO[C@H]1O[C@@H]2COC(C)O[C@H]2[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C9H16O6/c1-4-13-3-5-8(14-4)6(10)7(11)9(12-2)15-5/h4-11H,3H2,1-2H3/t4?,5-,6+,7-,8-,9+/m1/s1 |
| InChIKey | BSBOLIVKPWXZAN-WNGUHFOPSA-N |
| XLogP | -1.16 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |