C10H19FO6 — CID 159072924
deuterio(fluoro)methane;6-methoxy-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol (PubChem CID 159072924) has the molecular formula C10H19FO6 and a molecular weight of 255.26 g/mol. Its IUPAC name is deuterio(fluoro)methane;6-methoxy-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol.
| Compound Name | deuterio(fluoro)methane;6-methoxy-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
|---|---|
| PubChem CID | 159072924 |
| Molecular Formula | C10H19FO6 |
| Molecular Weight | 255.26 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | deuterio(fluoro)methane;6-methoxy-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
| SMILES | COC1OC2COC(C)OC2C(O)C1O.[2H]CF |
| InChI | InChI=1S/C9H16O6.CH3F/c1-4-13-3-5-8(14-4)6(10)7(11)9(12-2)15-5;1-2/h4-11H,3H2,1-2H3;1H3/i;1D |
| InChIKey | JZWVSURPHIDYPC-DIYDOPDJSA-N |
| XLogP | -0.57 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.26 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |