C14H13F5O6 — CID 101272898
(4aR,6S,7R,8R,8aR)-6-methoxy-2-(2,3,4,5,6-pentafluorophenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol (PubChem CID 101272898) has the molecular formula C14H13F5O6 and a molecular weight of 372.24 g/mol. Its IUPAC name is (4aR,6S,7R,8R,8aR)-6-methoxy-2-(2,3,4,5,6-pentafluorophenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol.
| Compound Name | (4aR,6S,7R,8R,8aR)-6-methoxy-2-(2,3,4,5,6-pentafluorophenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
|---|---|
| PubChem CID | 101272898 |
| Molecular Formula | C14H13F5O6 |
| Molecular Weight | 372.24 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | (4aR,6S,7R,8R,8aR)-6-methoxy-2-(2,3,4,5,6-pentafluorophenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
| SMILES | CO[C@H]1O[C@@H]2COC(c3c(F)c(F)c(F)c(F)c3F)O[C@@H]2[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H13F5O6/c1-22-14-11(21)10(20)12-3(24-14)2-23-13(25-12)4-5(15)7(17)9(19)8(18)6(4)16/h3,10-14,20-21H,2H2,1H3/t3-,10-,11-,12+,13?,14+/m1/s1 |
| InChIKey | MEHFTUKTWHIIDV-NQOUEXMZSA-N |
| XLogP | 0.89 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|