C14H18O8 — CID 22844555
(4aR,6S,7R,8R,8aR)-2-(3,4-dihydroxyphenyl)-6-methoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol (PubChem CID 22844555) has the molecular formula C14H18O8 and a molecular weight of 314.29 g/mol. Its IUPAC name is (4aR,6S,7R,8R,8aR)-2-(3,4-dihydroxyphenyl)-6-methoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol.
| Compound Name | (4aR,6S,7R,8R,8aR)-2-(3,4-dihydroxyphenyl)-6-methoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
|---|---|
| PubChem CID | 22844555 |
| Molecular Formula | C14H18O8 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | (4aR,6S,7R,8R,8aR)-2-(3,4-dihydroxyphenyl)-6-methoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
| SMILES | CO[C@H]1O[C@@H]2COC(c3ccc(O)c(O)c3)O[C@@H]2[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H18O8/c1-19-14-11(18)10(17)12-9(21-14)5-20-13(22-12)6-2-3-7(15)8(16)4-6/h2-4,9-18H,5H2,1H3/t9-,10-,11-,12+,13?,14+/m1/s1 |
| InChIKey | UFUHNUUFPUIUSL-CQMHSGHYSA-N |
| XLogP | -0.40 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|