C18H20O6 — CID 101384545
(4aR,6R,7R,8R,8aS)-6-methoxy-2-naphthalen-2-yl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol (PubChem CID 101384545) has the molecular formula C18H20O6 and a molecular weight of 332.35 g/mol. Its IUPAC name is (4aR,6R,7R,8R,8aS)-6-methoxy-2-naphthalen-2-yl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol.
| Compound Name | (4aR,6R,7R,8R,8aS)-6-methoxy-2-naphthalen-2-yl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
|---|---|
| PubChem CID | 101384545 |
| Molecular Formula | C18H20O6 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | (4aR,6R,7R,8R,8aS)-6-methoxy-2-naphthalen-2-yl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
| SMILES | CO[C@@H]1O[C@@H]2COC(c3ccc4ccccc4c3)O[C@H]2[C@H](O)[C@H]1O |
| InChI | InChI=1S/C18H20O6/c1-21-18-15(20)14(19)16-13(23-18)9-22-17(24-16)12-7-6-10-4-2-3-5-11(10)8-12/h2-8,13-20H,9H2,1H3/t13-,14-,15-,16-,17?,18-/m1/s1 |
| InChIKey | YJIFFOONNJBFSB-DBISQMLMSA-N |
| XLogP | 1.35 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |