C12H16O6S — CID 20680284
6-methoxy-2-thiophen-2-yl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol (PubChem CID 20680284) has the molecular formula C12H16O6S and a molecular weight of 288.32 g/mol. Its IUPAC name is 6-methoxy-2-thiophen-2-yl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol.
| Compound Name | 6-methoxy-2-thiophen-2-yl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
|---|---|
| PubChem CID | 20680284 |
| Molecular Formula | C12H16O6S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 6-methoxy-2-thiophen-2-yl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
| SMILES | COC1OC2COC(c3cccs3)OC2C(O)C1O |
| InChI | InChI=1S/C12H16O6S/c1-15-12-9(14)8(13)10-6(17-12)5-16-11(18-10)7-3-2-4-19-7/h2-4,6,8-14H,5H2,1H3 |
| InChIKey | NYUAKYVDAMFPKX-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |