C10H14Cl2O7 — CID 174900465
[(4aR,6S,7R,8R,8aS)-7,8-dihydroxy-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] 2,2-dichloroacetate (PubChem CID 174900465) has the molecular formula C10H14Cl2O7 and a molecular weight of 317.12 g/mol. Its IUPAC name is [(4aR,6S,7R,8R,8aS)-7,8-dihydroxy-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] 2,2-dichloroacetate.
| Compound Name | [(4aR,6S,7R,8R,8aS)-7,8-dihydroxy-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] 2,2-dichloroacetate |
|---|---|
| PubChem CID | 174900465 |
| Molecular Formula | C10H14Cl2O7 |
| Molecular Weight | 317.12 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | [(4aR,6S,7R,8R,8aS)-7,8-dihydroxy-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] 2,2-dichloroacetate |
| SMILES | CC1OC[C@H]2O[C@@H](OC(=O)C(Cl)Cl)[C@H](O)[C@@H](O)[C@@H]2O1 |
| InChI | InChI=1S/C10H14Cl2O7/c1-3-16-2-4-7(17-3)5(13)6(14)10(18-4)19-9(15)8(11)12/h3-8,10,13-14H,2H2,1H3/t3?,4-,5-,6-,7-,10+/m1/s1 |
| InChIKey | IOWZATFLOYBJAI-JSIHVUMBSA-N |
| XLogP | -0.46 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.12 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|