C8H14O5 — CID 129085380
(2S,4R)-2-[(4R)-2-methyl-1,3-dioxolan-4-yl]oxolane-3,4-diol (PubChem CID 129085380) has the molecular formula C8H14O5 and a molecular weight of 190.19 g/mol. Its IUPAC name is (2S,4R)-2-[(4R)-2-methyl-1,3-dioxolan-4-yl]oxolane-3,4-diol.
| Compound Name | (2S,4R)-2-[(4R)-2-methyl-1,3-dioxolan-4-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 129085380 |
| Molecular Formula | C8H14O5 |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | (2S,4R)-2-[(4R)-2-methyl-1,3-dioxolan-4-yl]oxolane-3,4-diol |
| SMILES | CC1OC[C@H]([C@H]2OC[C@@H](O)C2O)O1 |
| InChI | InChI=1S/C8H14O5/c1-4-11-3-6(13-4)8-7(10)5(9)2-12-8/h4-10H,2-3H2,1H3/t4?,5-,6-,7?,8-/m1/s1 |
| InChIKey | YXCKQODAKDAJNH-DJSSTOROSA-N |
| XLogP | -1.13 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |