C10H16O6 — CID 56636288
[(4aR,6S,8S,8aS)-6-hydroxy-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate (PubChem CID 56636288) has the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. Its IUPAC name is [(4aR,6S,8S,8aS)-6-hydroxy-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate.
| Compound Name | [(4aR,6S,8S,8aS)-6-hydroxy-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
|---|---|
| PubChem CID | 56636288 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | [(4aR,6S,8S,8aS)-6-hydroxy-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H](O)O[C@@H]2COC(C)O[C@@H]12 |
| InChI | InChI=1S/C10H16O6/c1-5(11)14-7-3-9(12)16-8-4-13-6(2)15-10(7)8/h6-10,12H,3-4H2,1-2H3/t6?,7-,8+,9-,10-/m0/s1 |
| InChIKey | DIGFECCPLNLEJI-NSRVDLHZSA-N |
| XLogP | -0.21 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |