C10H16O6 — CID 125036222
methyl (2R,4R,4aS,6S,8aR)-2,6-dimethyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine-4-carboxylate (PubChem CID 125036222) has the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. Its IUPAC name is methyl (2R,4R,4aS,6S,8aR)-2,6-dimethyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine-4-carboxylate.
| Compound Name | methyl (2R,4R,4aS,6S,8aR)-2,6-dimethyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine-4-carboxylate |
|---|---|
| PubChem CID | 125036222 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | methyl (2R,4R,4aS,6S,8aR)-2,6-dimethyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine-4-carboxylate |
| SMILES | COC(=O)[C@@H]1O[C@H](C)O[C@@H]2CO[C@H](C)O[C@@H]21 |
| InChI | InChI=1S/C10H16O6/c1-5-13-4-7-8(15-5)9(10(11)12-3)16-6(2)14-7/h5-9H,4H2,1-3H3/t5-,6+,7+,8-,9+/m0/s1 |
| InChIKey | VCNDSEBAIZTAPL-JTPBWFLFSA-N |
| XLogP | 0.05 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |