C9H16O3 — CID 59079572
(4aS,7S,8aS)-2,7-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 59079572) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is (4aS,7S,8aS)-2,7-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (4aS,7S,8aS)-2,7-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 59079572 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | (4aS,7S,8aS)-2,7-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | CC1OC[C@@H]2OC[C@@H](C)C[C@@H]2O1 |
| InChI | InChI=1S/C9H16O3/c1-6-3-8-9(11-4-6)5-10-7(2)12-8/h6-9H,3-5H2,1-2H3/t6-,7?,8-,9-/m0/s1 |
| InChIKey | ZJCPXSURRSCJKT-IVNRMCIBSA-N |
| XLogP | 1.17 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |