C11H20O3 — CID 58743215
(2R,4aR,6S,7R,8R,8aS)-2,6,7,8-tetramethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 58743215) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is (2R,4aR,6S,7R,8R,8aS)-2,6,7,8-tetramethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (2R,4aR,6S,7R,8R,8aS)-2,6,7,8-tetramethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 58743215 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | (2R,4aR,6S,7R,8R,8aS)-2,6,7,8-tetramethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | C[C@@H]1OC[C@H]2O[C@@H](C)[C@H](C)[C@@H](C)[C@@H]2O1 |
| InChI | InChI=1S/C11H20O3/c1-6-7(2)11-10(13-8(6)3)5-12-9(4)14-11/h6-11H,5H2,1-4H3/t6-,7-,8+,9-,10-,11+/m1/s1 |
| InChIKey | AMQXKCHTBCYYOT-PMXSCFQLSA-N |
| XLogP | 1.81 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |