C9H16O11S2 — CID 59034156
2,6-dimethyl-7,8-bis(trioxidanylsulfanyloxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 59034156) has the molecular formula C9H16O11S2 and a molecular weight of 364.35 g/mol. Its IUPAC name is 2,6-dimethyl-7,8-bis(trioxidanylsulfanyloxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | 2,6-dimethyl-7,8-bis(trioxidanylsulfanyloxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 59034156 |
| Molecular Formula | C9H16O11S2 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | 2,6-dimethyl-7,8-bis(trioxidanylsulfanyloxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | CC1OCC2OC(C)C(OSOOO)C(OSOOO)C2O1 |
| InChI | InChI=1S/C9H16O11S2/c1-4-7(15-21-19-17-10)9(16-22-20-18-11)8-6(13-4)3-12-5(2)14-8/h4-11H,3H2,1-2H3 |
| InChIKey | MOJLEPFQYCTMQO-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 123.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|