C18H30O7 — CID 57289915
7-[(1R,2R,3R,5S)-5-acetyloxy-3-hydroxy-2-[(4S)-2-methyl-1,3-dioxolan-4-yl]cyclopentyl]heptanoic acid (PubChem CID 57289915) has the molecular formula C18H30O7 and a molecular weight of 358.43 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-5-acetyloxy-3-hydroxy-2-[(4S)-2-methyl-1,3-dioxolan-4-yl]cyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,3R,5S)-5-acetyloxy-3-hydroxy-2-[(4S)-2-methyl-1,3-dioxolan-4-yl]cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 57289915 |
| Molecular Formula | C18H30O7 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-5-acetyloxy-3-hydroxy-2-[(4S)-2-methyl-1,3-dioxolan-4-yl]cyclopentyl]heptanoic acid |
| SMILES | CC(=O)O[C@H]1C[C@@H](O)[C@H]([C@H]2COC(C)O2)[C@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C18H30O7/c1-11(19)24-15-9-14(20)18(16-10-23-12(2)25-16)13(15)7-5-3-4-6-8-17(21)22/h12-16,18,20H,3-10H2,1-2H3,(H,21,22)/t12?,13-,14+,15-,16+,18+/m0/s1 |
| InChIKey | JJTIIBFEBGOZKL-HTBQLIEKSA-N |
| XLogP | 2.10 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|