C7H12O6 — CID 126761370
(4aR,6S,7R,8R,8aS)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6,7,8-triol (PubChem CID 126761370) has the molecular formula C7H12O6 and a molecular weight of 192.17 g/mol. Its IUPAC name is (4aR,6S,7R,8R,8aS)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6,7,8-triol.
| Compound Name | (4aR,6S,7R,8R,8aS)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6,7,8-triol |
|---|---|
| PubChem CID | 126761370 |
| Molecular Formula | C7H12O6 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | (4aR,6S,7R,8R,8aS)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6,7,8-triol |
| SMILES | O[C@@H]1[C@@H](O)[C@@H](O)O[C@@H]2COCO[C@@H]12 |
| InChI | InChI=1S/C7H12O6/c8-4-5(9)7(10)13-3-1-11-2-12-6(3)4/h3-10H,1-2H2/t3-,4-,5-,6-,7+/m1/s1 |
| InChIKey | RBQSEYUCWWZRJR-GKHCUFPYSA-N |
| XLogP | -2.20 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |