C9H11F3O7S — CID 101489532
[(3R,3aR,6S,6aS)-6-(trifluoromethylsulfonyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] acetate (PubChem CID 101489532) has the molecular formula C9H11F3O7S and a molecular weight of 320.24 g/mol. Its IUPAC name is [(3R,3aR,6S,6aS)-6-(trifluoromethylsulfonyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] acetate.
| Compound Name | [(3R,3aR,6S,6aS)-6-(trifluoromethylsulfonyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] acetate |
|---|---|
| PubChem CID | 101489532 |
| Molecular Formula | C9H11F3O7S |
| Molecular Weight | 320.24 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | [(3R,3aR,6S,6aS)-6-(trifluoromethylsulfonyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H11F3O7S/c1-4(13)18-5-2-16-8-6(3-17-7(5)8)19-20(14,15)9(10,11)12/h5-8H,2-3H2,1H3/t5-,6+,7-,8-/m1/s1 |
| InChIKey | VMJUINDRFKCHQD-ULAWRXDQSA-N |
| XLogP | -0.05 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.24 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|