C13H21NO7 — CID 121353630
(5-acetamido-4-acetyloxy-6-methoxyoxan-2-yl)methyl acetate (PubChem CID 121353630) has the molecular formula C13H21NO7 and a molecular weight of 303.31 g/mol. Its IUPAC name is (5-acetamido-4-acetyloxy-6-methoxyoxan-2-yl)methyl acetate.
| Compound Name | (5-acetamido-4-acetyloxy-6-methoxyoxan-2-yl)methyl acetate |
|---|---|
| PubChem CID | 121353630 |
| Molecular Formula | C13H21NO7 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | (5-acetamido-4-acetyloxy-6-methoxyoxan-2-yl)methyl acetate |
| SMILES | COC1OC(COC(C)=O)CC(OC(C)=O)C1NC(C)=O |
| InChI | InChI=1S/C13H21NO7/c1-7(15)14-12-11(20-9(3)17)5-10(6-19-8(2)16)21-13(12)18-4/h10-13H,5-6H2,1-4H3,(H,14,15) |
| InChIKey | OCGCMXRNHFEHEX-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |