C16H20O5S2 — CID 144905681
[(4R,5R)-5-methoxy-4-methylsulfanylcarbothioyloxyoxolan-2-yl]methyl 4-methylbenzoate (PubChem CID 144905681) has the molecular formula C16H20O5S2 and a molecular weight of 356.47 g/mol. Its IUPAC name is [(4R,5R)-5-methoxy-4-methylsulfanylcarbothioyloxyoxolan-2-yl]methyl 4-methylbenzoate.
| Compound Name | [(4R,5R)-5-methoxy-4-methylsulfanylcarbothioyloxyoxolan-2-yl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 144905681 |
| Molecular Formula | C16H20O5S2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | [(4R,5R)-5-methoxy-4-methylsulfanylcarbothioyloxyoxolan-2-yl]methyl 4-methylbenzoate |
| SMILES | CO[C@@H]1OC(COC(=O)c2ccc(C)cc2)C[C@H]1OC(=S)SC |
| InChI | InChI=1S/C16H20O5S2/c1-10-4-6-11(7-5-10)14(17)19-9-12-8-13(15(18-2)20-12)21-16(22)23-3/h4-7,12-13,15H,8-9H2,1-3H3/t12?,13-,15-/m1/s1 |
| InChIKey | RTDUAKQOBQIISB-JYRZLJSNSA-N |
| XLogP | 2.95 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|