C32H38O10S4 — CID 162052417
[(2R,3R,4R,5R)-5-methoxy-3,4-bis(methylsulfanylcarbothioyloxy)oxolan-2-yl]methyl 4-methylbenzoate;[(2S,5R)-5-methoxy-2,5-dihydrofuran-2-yl]methyl 4-methylbenzoate (PubChem CID 162052417) has the molecular formula C32H38O10S4 and a molecular weight of 710.91 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-methoxy-3,4-bis(methylsulfanylcarbothioyloxy)oxolan-2-yl]methyl 4-methylbenzoate;[(2S,5R)-5-methoxy-2,5-dihydrofuran-2-yl]methyl 4-methylbenzoate.
| Compound Name | [(2R,3R,4R,5R)-5-methoxy-3,4-bis(methylsulfanylcarbothioyloxy)oxolan-2-yl]methyl 4-methylbenzoate;[(2S,5R)-5-methoxy-2,5-dihydrofuran-2-yl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 162052417 |
| Molecular Formula | C32H38O10S4 |
| Molecular Weight | 710.91 g/mol |
| Exact Mass | 710.13 |
| IUPAC Name | [(2R,3R,4R,5R)-5-methoxy-3,4-bis(methylsulfanylcarbothioyloxy)oxolan-2-yl]methyl 4-methylbenzoate;[(2S,5R)-5-methoxy-2,5-dihydrofuran-2-yl]methyl 4-methylbenzoate |
| SMILES | CO[C@@H]1O[C@H](COC(=O)c2ccc(C)cc2)[C@@H](OC(=S)SC)[C@H]1OC(=S)SC.CO[C@H]1C=C[C@@H](COC(=O)c2ccc(C)cc2)O1 |
| InChI | InChI=1S/C18H22O6S4.C14H16O4/c1-10-5-7-11(8-6-10)15(19)21-9-12-13(23-17(25)27-3)14(16(20-2)22-12)24-18(26)28-4;1-10-3-5-11(6-4-10)14(15)17-9-12-7-8-13(16-2)18-12/h5-8,12-14,16H,9H2,1-4H3;3-8,12-13H,9H2,1-2H3/t12-,13-,14-,16-;12-,13+/m10/s1 |
| InChIKey | YYSIGBVARLUTPW-LPTYPWPISA-N |
| XLogP | 5.67 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.91 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|