C11H18O7S2 — CID 88887614
O-[(2R,5R)-4,5-dimethoxy-2-(methoxycarbonyloxymethyl)oxolan-3-yl] methylsulfanylmethanethioate (PubChem CID 88887614) has the molecular formula C11H18O7S2 and a molecular weight of 326.39 g/mol. Its IUPAC name is O-[(2R,5R)-4,5-dimethoxy-2-(methoxycarbonyloxymethyl)oxolan-3-yl] methylsulfanylmethanethioate.
| Compound Name | O-[(2R,5R)-4,5-dimethoxy-2-(methoxycarbonyloxymethyl)oxolan-3-yl] methylsulfanylmethanethioate |
|---|---|
| PubChem CID | 88887614 |
| Molecular Formula | C11H18O7S2 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | O-[(2R,5R)-4,5-dimethoxy-2-(methoxycarbonyloxymethyl)oxolan-3-yl] methylsulfanylmethanethioate |
| SMILES | COC(=O)OC[C@H]1O[C@@H](OC)C(OC)C1OC(=S)SC |
| InChI | InChI=1S/C11H18O7S2/c1-13-8-7(18-11(19)20-4)6(17-9(8)14-2)5-16-10(12)15-3/h6-9H,5H2,1-4H3/t6-,7?,8?,9-/m1/s1 |
| InChIKey | DFGYFRJSFBQQQI-MDVIFZSFSA-N |
| XLogP | 1.19 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|