C32H34O8 — CID 91256999
[(3R,4S,6R)-6-methoxy-3-methyl-4,5-bis[(4-methylbenzoyl)oxy]oxan-2-yl]methyl 4-methylbenzoate (PubChem CID 91256999) has the molecular formula C32H34O8 and a molecular weight of 546.62 g/mol. Its IUPAC name is [(3R,4S,6R)-6-methoxy-3-methyl-4,5-bis[(4-methylbenzoyl)oxy]oxan-2-yl]methyl 4-methylbenzoate.
| Compound Name | [(3R,4S,6R)-6-methoxy-3-methyl-4,5-bis[(4-methylbenzoyl)oxy]oxan-2-yl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 91256999 |
| Molecular Formula | C32H34O8 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | [(3R,4S,6R)-6-methoxy-3-methyl-4,5-bis[(4-methylbenzoyl)oxy]oxan-2-yl]methyl 4-methylbenzoate |
| SMILES | CO[C@@H]1OC(COC(=O)c2ccc(C)cc2)[C@@H](C)[C@H](OC(=O)c2ccc(C)cc2)C1OC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C32H34O8/c1-19-6-12-23(13-7-19)29(33)37-18-26-22(4)27(39-30(34)24-14-8-20(2)9-15-24)28(32(36-5)38-26)40-31(35)25-16-10-21(3)11-17-25/h6-17,22,26-28,32H,18H2,1-5H3/t22-,26?,27+,28?,32-/m1/s1 |
| InChIKey | MIRCDSFPLJDODQ-RETHZDMPSA-N |
| XLogP | 5.23 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|