C28H23Br3O9 — CID 22858893
[(2R,3R,4S,5R,6R)-4,5-bis[(4-bromobenzoyl)oxy]-3-hydroxy-6-methoxyoxan-2-yl]methyl 4-bromobenzoate (PubChem CID 22858893) has the molecular formula C28H23Br3O9 and a molecular weight of 743.20 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-4,5-bis[(4-bromobenzoyl)oxy]-3-hydroxy-6-methoxyoxan-2-yl]methyl 4-bromobenzoate.
| Compound Name | [(2R,3R,4S,5R,6R)-4,5-bis[(4-bromobenzoyl)oxy]-3-hydroxy-6-methoxyoxan-2-yl]methyl 4-bromobenzoate |
|---|---|
| PubChem CID | 22858893 |
| Molecular Formula | C28H23Br3O9 |
| Molecular Weight | 743.20 g/mol |
| Exact Mass | 739.89 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-4,5-bis[(4-bromobenzoyl)oxy]-3-hydroxy-6-methoxyoxan-2-yl]methyl 4-bromobenzoate |
| SMILES | CO[C@@H]1O[C@H](COC(=O)c2ccc(Br)cc2)[C@@H](O)[C@H](OC(=O)c2ccc(Br)cc2)[C@H]1OC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C28H23Br3O9/c1-36-28-24(40-27(35)17-6-12-20(31)13-7-17)23(39-26(34)16-4-10-19(30)11-5-16)22(32)21(38-28)14-37-25(33)15-2-8-18(29)9-3-15/h2-13,21-24,28,32H,14H2,1H3/t21-,22-,23+,24-,28-/m1/s1 |
| InChIKey | RGRHJRDCKYAJIY-SHHGKLNCSA-N |
| XLogP | 5.31 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.20 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|