C41H36Br4O15 — CID 11136929
[(2R,3R,4S,5R,6R)-3,4,5-tris[(4-bromobenzoyl)oxy]-6-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methoxy]oxan-2-yl]methyl 4-bromobenzoate (PubChem CID 11136929) has the molecular formula C41H36Br4O15 and a molecular weight of 1088.34 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-tris[(4-bromobenzoyl)oxy]-6-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methoxy]oxan-2-yl]methyl 4-bromobenzoate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-tris[(4-bromobenzoyl)oxy]-6-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methoxy]oxan-2-yl]methyl 4-bromobenzoate |
|---|---|
| PubChem CID | 11136929 |
| Molecular Formula | C41H36Br4O15 |
| Molecular Weight | 1088.34 g/mol |
| Exact Mass | 1083.88 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-tris[(4-bromobenzoyl)oxy]-6-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methoxy]oxan-2-yl]methyl 4-bromobenzoate |
| SMILES | CO[C@@H]1O[C@H](CO[C@@H]2O[C@H](COC(=O)c3ccc(Br)cc3)[C@@H](OC(=O)c3ccc(Br)cc3)[C@H](OC(=O)c3ccc(Br)cc3)[C@H]2OC(=O)c2ccc(Br)cc2)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C41H36Br4O15/c1-53-40-32(48)31(47)30(46)28(56-40)18-55-41-35(60-39(52)23-8-16-27(45)17-9-23)34(59-38(51)22-6-14-26(44)15-7-22)33(58-37(50)21-4-12-25(43)13-5-21)29(57-41)19-54-36(49)20-2-10-24(42)11-3-20/h2-17,28-35,40-41,46-48H,18-19H2,1H3/t28-,29-,30-,31+,32-,33-,34+,35-,40-,41-/m1/s1 |
| InChIKey | PYHMQXOLCWTBHA-VQLOLIPKSA-N |
| XLogP | 5.77 |
| TPSA | 202.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1088.34 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|