C32H31Cl3O8 — CID 58660046
[(3S,4S,6R)-4,5-bis[(3-chloro-4-methylbenzoyl)oxy]-6-methoxy-3-methyloxan-2-yl]methyl 3-chloro-4-methylbenzoate (PubChem CID 58660046) has the molecular formula C32H31Cl3O8 and a molecular weight of 649.95 g/mol. Its IUPAC name is [(3S,4S,6R)-4,5-bis[(3-chloro-4-methylbenzoyl)oxy]-6-methoxy-3-methyloxan-2-yl]methyl 3-chloro-4-methylbenzoate.
| Compound Name | [(3S,4S,6R)-4,5-bis[(3-chloro-4-methylbenzoyl)oxy]-6-methoxy-3-methyloxan-2-yl]methyl 3-chloro-4-methylbenzoate |
|---|---|
| PubChem CID | 58660046 |
| Molecular Formula | C32H31Cl3O8 |
| Molecular Weight | 649.95 g/mol |
| Exact Mass | 648.11 |
| IUPAC Name | [(3S,4S,6R)-4,5-bis[(3-chloro-4-methylbenzoyl)oxy]-6-methoxy-3-methyloxan-2-yl]methyl 3-chloro-4-methylbenzoate |
| SMILES | CO[C@@H]1OC(COC(=O)c2ccc(C)c(Cl)c2)[C@H](C)[C@H](OC(=O)c2ccc(C)c(Cl)c2)C1OC(=O)c1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C32H31Cl3O8/c1-16-6-9-20(12-23(16)33)29(36)40-15-26-19(4)27(42-30(37)21-10-7-17(2)24(34)13-21)28(32(39-5)41-26)43-31(38)22-11-8-18(3)25(35)14-22/h6-14,19,26-28,32H,15H2,1-5H3/t19-,26?,27-,28?,32+/m0/s1 |
| InChIKey | ACEKYLZFBLCABX-XVQGJIRWSA-N |
| XLogP | 7.19 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.95 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|