C14H16O4 — CID 163794761
[(5R)-5-methoxy-2,5-dihydrofuran-2-yl]methyl 4-methylbenzoate (PubChem CID 163794761) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is [(5R)-5-methoxy-2,5-dihydrofuran-2-yl]methyl 4-methylbenzoate.
| Compound Name | [(5R)-5-methoxy-2,5-dihydrofuran-2-yl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 163794761 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | [(5R)-5-methoxy-2,5-dihydrofuran-2-yl]methyl 4-methylbenzoate |
| SMILES | CO[C@H]1C=CC(COC(=O)c2ccc(C)cc2)O1 |
| InChI | InChI=1S/C14H16O4/c1-10-3-5-11(6-4-10)14(15)17-9-12-7-8-13(16-2)18-12/h3-8,12-13H,9H2,1-2H3/t12?,13-/m1/s1 |
| InChIKey | MZUWXJCUSAZDMP-ZGTCLIOFSA-N |
| XLogP | 2.08 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|