C13H16O5 — CID 169437438
[(2R,3S)-3,5-dihydroxyoxolan-2-yl]methyl 4-methylbenzoate (PubChem CID 169437438) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is [(2R,3S)-3,5-dihydroxyoxolan-2-yl]methyl 4-methylbenzoate.
| Compound Name | [(2R,3S)-3,5-dihydroxyoxolan-2-yl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 169437438 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | [(2R,3S)-3,5-dihydroxyoxolan-2-yl]methyl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC[C@H]2OC(O)C[C@@H]2O)cc1 |
| InChI | InChI=1S/C13H16O5/c1-8-2-4-9(5-3-8)13(16)17-7-11-10(14)6-12(15)18-11/h2-5,10-12,14-15H,6-7H2,1H3/t10-,11+,12?/m0/s1 |
| InChIKey | BFMLFVTWRPFYHJ-WIKAKEFZSA-N |
| XLogP | 0.62 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |