About [(3R,5R)-3-methoxy-5-(methoxymethyl)oxolan-2-yl]methyl 4-methylbenzoate;4-methylbenzaldehyde
[(3R,5R)-3-methoxy-5-(methoxymethyl)oxolan-2-yl]methyl 4-methylbenzoate;4-methylbenzaldehyde (PubChem CID 142541640) has the molecular formula C24H30O6
and a molecular weight of 414.50 g/mol. Its IUPAC name is [(3R,5R)-3-methoxy-5-(methoxymethyl)oxolan-2-yl]methyl 4-methylbenzoate;4-methylbenzaldehyde.
Molecular Properties
| Compound Name | [(3R,5R)-3-methoxy-5-(methoxymethyl)oxolan-2-yl]methyl 4-methylbenzoate;4-methylbenzaldehyde |
| PubChem CID | 142541640 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | [(3R,5R)-3-methoxy-5-(methoxymethyl)oxolan-2-yl]methyl 4-methylbenzoate;4-methylbenzaldehyde |
| SMILES | COC[C@H]1C[C@@H](OC)C(COC(=O)c2ccc(C)cc2)O1.Cc1ccc(C=O)cc1 |
| InChI | InChI=1S/C16H22O5.C8H8O/c1-11-4-6-12(7-5-11)16(17)20-10-15-14(19-3)8-13(21-15)9-18-2;1-7-2-4-8(6-9)5-3-7/h4-7,13-15H,8-10H2,1-3H3;2-6H,1H3/t13-,14-,15?;/m1./s1 |
| InChIKey | RSFKIIUYOSWCHR-XBBYMFKQSA-N |
| XLogP | 3.78 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [(3R,5R)-3-methoxy-5-(methoxymethyl)oxolan-2-yl]methyl 4-methylbenzoate;4-methylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,5R)-3-methoxy-5-(methoxymethyl)oxolan-2-yl]methyl 4-methylbenzoate;4-methylbenzaldehyde?
The IUPAC name of [(3R,5R)-3-methoxy-5-(methoxymethyl)oxolan-2-yl]methyl 4-methylbenzoate;4-methylbenzaldehyde (CID 142541640) is [(3R,5R)-3-methoxy-5-(methoxymethyl)oxolan-2-yl]methyl 4-methylbenzoate;4-methylbenzaldehyde.
What is the SMILES notation for [(3R,5R)-3-methoxy-5-(methoxymethyl)oxolan-2-yl]methyl 4-methylbenzoate;4-methylbenzaldehyde?
The canonical SMILES for [(3R,5R)-3-methoxy-5-(methoxymethyl)oxolan-2-yl]methyl 4-methylbenzoate;4-methylbenzaldehyde is COC[C@H]1C[C@@H](OC)C(COC(=O)c2ccc(C)cc2)O1.Cc1ccc(C=O)cc1.
What is the InChIKey of [(3R,5R)-3-methoxy-5-(methoxymethyl)oxolan-2-yl]methyl 4-methylbenzoate;4-methylbenzaldehyde?
The InChIKey is RSFKIIUYOSWCHR-XBBYMFKQSA-N. The full InChI is InChI=1S/C16H22O5.C8H8O/c1-11-4-6-12(7-5-11)16(17)20-10-15-14(19-3)8-13(21-15)9-18-2;1-7-2-4-8(6-9)5-3-7/h4-7,13-15H,8-10H2,1-3H3;2-6H,1H3/t13-,14-,15?;/m1./s1.
What are the key properties of [(3R,5R)-3-methoxy-5-(methoxymethyl)oxolan-2-yl]methyl 4-methylbenzoate;4-methylbenzaldehyde?
[(3R,5R)-3-methoxy-5-(methoxymethyl)oxolan-2-yl]methyl 4-methylbenzoate;4-methylbenzaldehyde has a molecular weight of 414.50 g/mol, XLogP of 3.78, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,5R)-3-methoxy-5-(methoxymethyl)oxolan-2-yl]methyl 4-methylbenzoate;4-methylbenzaldehyde is sourced from PubChem (CID 142541640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).