C19H20O5 — CID 67760613
[(2S,4R,5S)-4-hydroxy-5-methoxyoxolan-2-yl]methyl 4-phenylbenzoate (PubChem CID 67760613) has the molecular formula C19H20O5 and a molecular weight of 328.36 g/mol. Its IUPAC name is [(2S,4R,5S)-4-hydroxy-5-methoxyoxolan-2-yl]methyl 4-phenylbenzoate.
| Compound Name | [(2S,4R,5S)-4-hydroxy-5-methoxyoxolan-2-yl]methyl 4-phenylbenzoate |
|---|---|
| PubChem CID | 67760613 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | [(2S,4R,5S)-4-hydroxy-5-methoxyoxolan-2-yl]methyl 4-phenylbenzoate |
| SMILES | CO[C@H]1O[C@H](COC(=O)c2ccc(-c3ccccc3)cc2)C[C@H]1O |
| InChI | InChI=1S/C19H20O5/c1-22-19-17(20)11-16(24-19)12-23-18(21)15-9-7-14(8-10-15)13-5-3-2-4-6-13/h2-10,16-17,19-20H,11-12H2,1H3/t16-,17+,19-/m0/s1 |
| InChIKey | XDKHPWZDJOGOBD-SCTDSRPQSA-N |
| XLogP | 2.63 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |