C11H15NO3 — CID 1126499
(2R,3S,5R)-5-anilino-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 1126499) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is (2R,3S,5R)-5-anilino-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,5R)-5-anilino-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 1126499 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | (2R,3S,5R)-5-anilino-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | OC[C@H]1O[C@@H](Nc2ccccc2)C[C@@H]1O |
| InChI | InChI=1S/C11H15NO3/c13-7-10-9(14)6-11(15-10)12-8-4-2-1-3-5-8/h1-5,9-14H,6-7H2/t9-,10+,11+/m0/s1 |
| InChIKey | OYCBOKNPGJKONC-HBNTYKKESA-N |
| XLogP | 0.57 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |