C12H17N2O5- — CID 163137734
2-(hydroxymethyl)-5-[3-[hydroxy(oxido)amino]-4-methylanilino]oxolan-3-ol (PubChem CID 163137734) has the molecular formula C12H17N2O5- and a molecular weight of 269.28 g/mol. Its IUPAC name is 2-(hydroxymethyl)-5-[3-[hydroxy(oxido)amino]-4-methylanilino]oxolan-3-ol.
| Compound Name | 2-(hydroxymethyl)-5-[3-[hydroxy(oxido)amino]-4-methylanilino]oxolan-3-ol |
|---|---|
| PubChem CID | 163137734 |
| Molecular Formula | C12H17N2O5- |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 2-(hydroxymethyl)-5-[3-[hydroxy(oxido)amino]-4-methylanilino]oxolan-3-ol |
| SMILES | Cc1ccc(NC2CC(O)C(CO)O2)cc1N([O-])O |
| InChI | InChI=1S/C12H17N2O5/c1-7-2-3-8(4-9(7)14(17)18)13-12-5-10(16)11(6-15)19-12/h2-4,10-13,15-17H,5-6H2,1H3/q-1 |
| InChIKey | ZUGSHKPPWVSPEP-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|