C12H17N2O6- — CID 163171285
2-[3-[hydroxy(oxido)amino]-4-methylanilino]oxane-3,4,5-triol (PubChem CID 163171285) has the molecular formula C12H17N2O6- and a molecular weight of 285.28 g/mol. Its IUPAC name is 2-[3-[hydroxy(oxido)amino]-4-methylanilino]oxane-3,4,5-triol.
| Compound Name | 2-[3-[hydroxy(oxido)amino]-4-methylanilino]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 163171285 |
| Molecular Formula | C12H17N2O6- |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-[3-[hydroxy(oxido)amino]-4-methylanilino]oxane-3,4,5-triol |
| SMILES | Cc1ccc(NC2OCC(O)C(O)C2O)cc1N([O-])O |
| InChI | InChI=1S/C12H17N2O6/c1-6-2-3-7(4-8(6)14(18)19)13-12-11(17)10(16)9(15)5-20-12/h2-4,9-13,15-18H,5H2,1H3/q-1 |
| InChIKey | DGHRWRQDIXLDSG-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|