C11H14N2O9S — CID 42533832
2-nitro-4-[[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]amino]benzenesulfonic acid (PubChem CID 42533832) has the molecular formula C11H14N2O9S and a molecular weight of 350.31 g/mol. Its IUPAC name is 2-nitro-4-[[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]amino]benzenesulfonic acid.
| Compound Name | 2-nitro-4-[[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 42533832 |
| Molecular Formula | C11H14N2O9S |
| Molecular Weight | 350.31 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 2-nitro-4-[[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]amino]benzenesulfonic acid |
| SMILES | O=[N+]([O-])c1cc(N[C@@H]2OC[C@@H](O)[C@H](O)[C@H]2O)ccc1S(=O)(=O)O |
| InChI | InChI=1S/C11H14N2O9S/c14-7-4-22-11(10(16)9(7)15)12-5-1-2-8(23(19,20)21)6(3-5)13(17)18/h1-3,7,9-12,14-16H,4H2,(H,19,20,21)/t7-,9+,10-,11-/m1/s1 |
| InChIKey | FDYSBHKUFSCUAV-APHKKCJPSA-N |
| XLogP | -1.31 |
| TPSA | 179.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.31 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|