C11H15NO5 — CID 7452610
(2R,3S,4R,5R)-2-(4-hydroxyanilino)oxane-3,4,5-triol (PubChem CID 7452610) has the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(4-hydroxyanilino)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R)-2-(4-hydroxyanilino)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 7452610 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | (2R,3S,4R,5R)-2-(4-hydroxyanilino)oxane-3,4,5-triol |
| SMILES | Oc1ccc(N[C@@H]2OC[C@@H](O)[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C11H15NO5/c13-7-3-1-6(2-4-7)12-11-10(16)9(15)8(14)5-17-11/h1-4,8-16H,5H2/t8-,9-,10+,11-/m1/s1 |
| InChIKey | HDWNWEZUZNQNHS-CHWFTXMASA-N |
| XLogP | -0.76 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|