C11H15N2O6- — CID 163181390
(2S,3R,4R,5R)-2-[3-[hydroxy(oxido)amino]anilino]oxane-3,4,5-triol (PubChem CID 163181390) has the molecular formula C11H15N2O6- and a molecular weight of 271.25 g/mol. Its IUPAC name is (2S,3R,4R,5R)-2-[3-[hydroxy(oxido)amino]anilino]oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5R)-2-[3-[hydroxy(oxido)amino]anilino]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 163181390 |
| Molecular Formula | C11H15N2O6- |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | (2S,3R,4R,5R)-2-[3-[hydroxy(oxido)amino]anilino]oxane-3,4,5-triol |
| SMILES | [O-]N(O)c1cccc(N[C@H]2OC[C@@H](O)[C@@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C11H15N2O6/c14-8-5-19-11(10(16)9(8)15)12-6-2-1-3-7(4-6)13(17)18/h1-4,8-12,14-17H,5H2/q-1/t8-,9-,10-,11+/m1/s1 |
| InChIKey | YINIMDRQRTWIRS-DBIOUOCHSA-N |
| XLogP | -0.77 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|